Главная Обратная связь

Дисциплины:






В завданнях 209-234 методом іонно-електронного балансу розставте коефіцієнти в окисно-відновних реакціях



 

209*а) KMnO4 + MnSO4 + H2O → MnO2 + K2SO4 + H2SO4;
б) C + HNO3 → CO2 + NO2 + H2O;
в) K2Cr2O7 + HBr → Br2 + KBr + CrBr3 + H2O.
210*а) Cl2 + KOH → KClO3 + KCl + H2O;
б) KNO2 + KI + H2SO4 → NO + I2 + K2SO4 + H2O;
в) KMnO4 + NaBr + H2SO4 → MnSO4 + Br2 + K2SO4 + Na2SO4 + H2O.
211*а) SO2 + Br2 + H2O → H2SO4 + HBr;
б) CrCl3 + NaClO + NaOH → Na2CrO4 + NaCl + H2O;
в) Si + KOH + H2O → K2SiO3 + H2.
212*а) Ca + HNO3 → Ca(NO3)2 + N2O + H2O;
б) KMnO4 + K2SO3 + KOH → K2MnO4 + K2SO4 + H2O;
в) NO2 + H2O → HNO3 + HNO2.
213*а) Na2SnO2 + Cl2 + NaOH + H2O → Na2[Sn(OH)6] + NaCl;
б) K2Cr2O7 + CO + H2SO4 → Cr2(SO4)3 + CO2 + K2SO4 + H2O;
в) Sn + HNO3 + H2O → H2SnO3 + NO.
214*а) K2Cr2O7 + NaNO2 + H2SO4 → Cr2(SO4)3 + Na2SO4 + K2SO4 + H2O;
б) MnO2 + KBr + H2SO4 → Br2 + MnSO4 + K2SO4 + H2O;
в) I2 + Ba(OH)2 → Ba(IO3)2 + BaI2 + H2O.
215*а) N2H4 → N2 + NH3;
б) SnCl2 + HgCl2 + HCl → Hg + H2[SnCl6];
в) Cr(NO3)3 + PbO2 + HNO3 → H2Cr2O7 + NO2 + Pb(NO3)2 + H2O.
216*а) S + Cl2 + H2O → HCl + H2SO4;
б) KMnO4 + K2S + H2SO4 → K2SO4 + MnSO4 + S + H2O;
в) MnO2 + O2 + KOH → K2MnO4 + H2O.
217*а) Zn + HNO3 → Zn(NO3)2 + NH4NO3 + H2O;
б) K2Cr2O7 + NaSO3 + H2SO4 → Cr2(SO4)3 + Na2SO4 + K2SO4 + H2O;
в) PH3 + KMnO4 + H2SO4 → K2SO4 + MnSO4 + H3PO4 + H2O.
218*а) ClO2 + Ba(OH)2 → Ba(ClO2)2 + Ba(ClO3)2 + H2O;
б) K2[Sn(OH)4] + Bi(NO3)3 + KOH → K2[Sn(OH)6] + Bi + KNO3;
в) K2Cr2O7 + H2O2 + H2SO4 → Cr2(SO4)3 + O2 + K2SO4 + H2O.
219*а) KMnO4 + K2HPO3 + KOH → K2MnO4 + K3PO4 + H2O;
б) K2Cr2O7 + FeSO4 + H2SO4 → Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H2O;
в) HClO4 + SO2 + H2O → H2SO4 + HCl.
220*а) KBrO → KBrO3 + KBr;
б) S + NaOH → Na2SO3 + Na2S + H2O;
в) Mn(OH)2 + Cl2 + KOH → MnO2 + KCl + H2O.
221*а) CuS + HNO3 → Cu(NO3)2 + H2SO4 +NO + H2O;
б) KMnO4 + Na3AsO3 + H2O → MnO2 + Na2AsO4 + KOH;
в) HClO3 → HClO4 + ClO2 + H2O.
222*а) K2Cr2O7+(NH4)2S+H2SO4 →S+Cr2(SO4)3+K2SO4+(NH4)2SO4+H2O.
б) SO2 + H2AsO4 + H2O → H2AsO3 + H2SO4;
в) MnO2 + KI + H2SO4 → K2SO4 + MnSO4 + I2 + H2O.
223*а) MnSO4 + KClO3 + KOH → K2MnO4 + KCl + K2SO4 + H2O;
б) Na2Cr2O7 + NaNO2 + H2SO4 → Cr2(SO4)3 + Na2SO4 + NaNO3 + H2O;
в) P + HNO3 + H2O → H3PO4 + NO.
224*а) Cr2O3 + Br2 + NaOH → Na2CrO4 + NaBr + H2O;
б) HNO2 → HNO3 + NO + H2O;
в) KMnO4 + HCl → MnCl2 + KCl + Cl2 + H2O.
225*а) K2Cr2O7 + Al + H2SO4 → Cr2(SO4)3 + Al2(SO4)3 + K2SO4 + H2O;
б) P + HClO3 + H2O → H3PO4 + HCl;
в) KMnO4 + KI + H2O → MnO2 + I2 + KOH.
226*а) Au + H2SeO4 → Au2(SeO4)3 + SeO2 + H2O;
б) K[Cr(OH)4] + Br2 + KOH → K2CrO4 + KBr + H2O;
в) Cl2 + KOH → KClO + KCl + H2O.
227*а) MnSO4 + PbO2 + H2SO4 → HMnO4 + PbSO4 + H2O.
б) Ni(OH)3 + HCl → NiCl2 + Cl2 +H2O;
в) Mo + HNO3 + HF → H2[MoF8] + NO2 + H2O.
228*а) KMnO4 + K2HPO3 + KOH → K2MnO4 + K3PO4 + H2O;
б) Fe(HCO3)2 + O2 + H2O → Fe(OH)3 + CO;
в) K2[Sn(OH)4] + Br2 + KOH → K2[Sn(OH)6] + KBr.
229*а) FeSO4 + KClO3 + H2SO4 → Fe2(SO4)3 + KCl + H2O;
б) SbSI + Cl2 + KOH → K[Sb(OH)6] + K2SO4 + KIO3 + KCl + H2O;
в) K2Cr2O7 + KI + H2SO4 → I2 + Cr2(SO4)3 + K2SO4 + H2O.
230*а) Ca(OH)2 + Br2 → Ca(BrO3)2 + CaBr2 + H2O;
б) Na2MnO4 +H2O → NaMnO4 + MnO2 + NaOH;
в) K2MnO4 + KI + H2SO4 → I2 + MnSO4 + K2SO4 + H2O.
231*а) K2Cr2O7 + H3PO3 + H2SO4 → H3PO4 + Cr2(SO4)3 + K2SO4 + H2O;
б) H2O2 +KMnO4 + H2O → Mn(OH)4 + O2 + KOH;
в) Hg + HNO3 → Hg2(NO3)2 + NO + H2O.
232*а) Br2 + NaOH → NaBrO3 + NaBr + H2O.
б) KMnO4 + K2SO3 + H2O → K2SO4 + MnO2 + KOH;
в) CoCl2 + NaNO2 + HCl → CoCl3 + NO + H2O;
233*а) Cu + H2SO4 → CuSO4 + SO2 + H2O;
б) MnO2 + KClO3 + KOH → K2MnO4 + KCl + H2O;
в) Al + NaOH + H2O → Na [Al(OH)4] + H2.
234*а) H2S + KMnO4 + H2SO4 ® S + MnSO4 + K2SO4 + H2O;
б) SO2 + K2Cr2O7 + H2SO4 ® K2SO4 + Cr2(SO4)3 + H2O;
в) Br2 + NaOH ® NaBrO3 + NaBr + H2O.
 

235. Виходячи з теплового ефекту реакції



3CaO(к) + P2O5(к) = Ca3(PO4)2(к); ∆H0=-739 кДж

визначте стандартну ентальпію утворення (∆H0298) кальцій ортофосфату.

 

236. Визначте ентальпію утворення озону з молекулярного кисню виходячи з теплот реакції окиснення As2O3 киснем і озоном:

As2O3(к) + О2(г) = As2O5(к); ∆H0=-271 кДж;
As2O3(к) + О3(г) = As2O5(к); ∆H0=-365 кДж.

 

237.Виходячи з теплового ефекту реакції розрахуйте ентальпію утворення кальцій карбіду СаС2:

СаО(к) + 3С(гр.) = СаС2 + СО(г); ∆H0= 460 кДж;

 

238.Виходячи з реакцій

KClO3(к) = KCl(к) + 0,5О2(г); ∆H0=-49,4 кДж;
KClO4(к) = KCl(к) + 2O2(г); ∆H0= 33 кДж;

розрахуйте ∆Н0 реакції

4KClO3(к) = 3KclO4(к) + KCl(к).

 

239.Виходячи з ∆H0298 утворення Н2О(г) та таких даних

FeO(к) + CO(г) = Fe(к) + CO2(г); ∆H0=-18,2 кДж;
2CO(г) + O2(г) = 2CO2(г); ∆H0=-566 кДж

розрахуйте ∆H0298 реакції

FeO(к) + Н2(г) = Fe(к) + Н2О(г).

 

240.Визначте, використовуючи довідкові дані, зміну ентропії реакцій за стандартних умов:

а) MgO(к) + H2(г) = Mg(к) + H2O(ж);  
б) C(гр.) + CO2(г) = 2CO(г);  
в) FeO(к) + CO(г) = Fe(к) + CO2(г).  

 

241.Визначте зміну ентропії в ході хімічної реакції

2H2S(г) + 3O2(г) = 3SO2(г) + 2H2O(р)  

в стандартних умовах. Чи ймовірний перебіг даної реакції при 298К?

 

242.Визначте зміну стандартної ентропії в наведених нижче реакціях та можливість їх перебігу при 298К:

а) 2HF(г) + O3(г) = H2O(р) + F2(г) + O2(г);  
б) H2(г) + Se(к) = H2Se(г);  
в) 2NH3(г) + O2(г) = 2NO(г) + 3 H2O(р).  

 

243.Визначте зміну стандартної ентропії в даних реакціях та можливість їх перебігу при 298К:

а) 2СО(г) = СО2(г) + С(гр.);  
б) NH4NO3(к) = N2O(г) + 2H2O(г);  
в) NH3(г) + HCl(г) = NH4Cl(к);  
г) SO2(г) + 2H2S(г) = 3S(к) + 2H2O(р).  

 

244.Не розраховуючи визначте, у яких хімічних реакціях ∆S0298 буде позитивною, негативною, або дорівнюватиме нулю:

а) 2NH3(г) = N2(г) + 3H2(г);  
б) CO2(к) = CO2(г) ;  
в) CaO(к) + CO2(г) = CaCO3(к);  
г) 4Fe(к) + 3O2(г) = 2Fe2O3(к);  
д) N2O4(г) = 2NO2(г);  
е) 2H2(г) + O2(г) = 2H2O(р).  

 

245.Визначте ∆G0298 реакцій та можливість їх перебігу при 298К:

а) N2O(г) + NO(г) = N2(г) + NO2(г);  
б) 2HF(г) + O2(г) = F2(г) + H2O(р);  
в) O3(г) + H2O(р) = 2O2(г) + H2O(р).  

 

246.Визначте, яка з наведених реакцій термодинамічно ймовірніша при стандартних умовах:

а)2H2S(г) + 3O2(г) = 2H2O(г) + 2SO2(г);  
б)2H2S(г) + O2(г) = 2H2O(г) + 2S(к).  

 

247.Визначте температуру розкладання таких речовин:

а) NH4NO3(к) = N2O(г) + 2H2O(г);  
б) (NH4)2CO3(к) = 2NH3(г) + CO2(г) + H2O(г).  

 

248.Визначте значення температур, у разі перевищення яких почнеться розкладання сульфатів лужноземельних металів за схемою:

2MeSO4(к) = 2MeO(к) + 2SO2(г) + O2(г).  

(∆H0298 та ∆S0298 від температури не залежать.)

 

249.Обчисліть ∆G0298 для реакції СаСО3(к) = СаО(к) + СО2(г) при температурах 25, 500 та 15000С. (∆H0298 та ∆S0298 від температури не залежать.)

 

250.Визначте, у скільки разів зміниться швидкість хімічної реакції

(г) + В(г) → А2В(г),  

якщо концентрацію речовини А збільшити вдвічі, а концентрацію речовини В зменшити вдвічі.

 

251.У системі

CO(г) + Cl2(г) → COCl2(г)  

концентрацію карбон (ІІ) оксиду збільшили з 1,2 моль/л до 1,5 моль/л, а хлору – з 1,2 моль/л до 2 моль/л. Визначте, у скільки разів при цьому збільшилась швидкість реакції.

 

252.Визначте вихідні концентрації речовин А та В для реакції

(г) + В(г) → 2С(г) + D(г),

якщо через деякий час після початку реакції концентрації речовин становили: [А]=0,03 моль/л, [В]=0,01 моль/л, [С]=0,008 моль/л.

 

253.Поясніть, як зміниться стан рівноваги в наведених реакціях у випадку підвищення тиску:

а) H2(г) + Cl2(г) «2HCl(г); г) 2CO(г) + O2(г) « 2CO2(г);
б) CaCO3(к) « CaO(к) + CO2(г); д) N2(г) + O2(г) « 2NO(г);
в) PCl3(г) + Cl2(г) « PCl(г)5; Е) CO(г) + H2O(г) « CO2(г) + H2(г).

 

254.Поясніть, як зміниться стан рівноваги в наведених реакціях у разі збільшення температури:

а) 2SO2(г) + O2(г) « 2SO3(г); ∆H<0; В) СО2(г) + С(гр.) « 2СО(г) ; ∆H>0;
б) N2(г) + O2(г) « 2NO(г); ∆H>0; Г) 2NO2(г) « N2O4(г); ∆H<0.

 

255.Дві реакції перебігають при 250С з однаковою швидкістю. Температурні коефіцієнти швидкості дорівнюють 2,0 – для першої реакції та 2,5 – для другої. Визначте відношення швидкостей цих реакцій при 950С.

 

256.Обчисліть, на скільки градусів потрібно підвищити температуру, щоб швидкість реакції збільшилась у 2,25 разу. Температурний коефіцієнт швидкості дорівнює 1,5.

 

257.Обчисліть, на скільки градусів потрібно підвищити температуру в системі, щоб швидкість реакції збільшилась: а) у 81 разів (γ=3); б) 243 рази (γ=3); в) 64 рази (γ=4).

 

258.Визначте, чому дорівнює температурний коефіцієнт швидкості реакції, якщо при підвищенні температури на 30°С, швидкість реакції збільшується в 15,6 разу.

 

259.При 1500С деяка реакція закінчується за 16 хв. Враховуючи, що температурний коефіцієнт швидкості реакції дорівнює 2,5, визначте, через який час закінчиться ця реакція, якщо її проводити при : а) 2000С; б) 800С.

 

260.Вихідні концентрації азоту та водню в суміші для одержання аміаку становили відповідно 4 моль/л та 10 моль/л. У момент рівноваги прореагувало 25% азоту. Обчисліть: а) рівноважні концентрації азоту, водню та аміаку; б) константу рівноваги.

 

 


ВАРІАНТИ ЗАВДАНЬ

№ варіанта Номери задач

 





sdamzavas.net - 2020 год. Все права принадлежат их авторам! В случае нарушение авторского права, обращайтесь по форме обратной связи...